* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | KINGSHCHEM 24337 |
English Synonyms: | KINGSHCHEM 24337 |
MDL Number.: | MFCD17181429 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1c(cc(c-2c1Cc3c2[nH]c(=O)s3)F)F |
InChi: | InChI=1S/C10H5F2NOS/c11-5-1-4-2-7-9(13-10(14)15-7)8(4)6(12)3-5/h1,3H,2H2,(H,13,14) |
InChiKey: | InChIKey=XHCZUSHRGHUJDW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.