* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 68275 |
| English Synonyms: | KINGSHCHEM 68275 |
| MDL Number.: | MFCD17212758 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1ccc2c(c1C)NC(=O)C(S2)C(=O)O |
| InChi: | InChI=1S/C11H11NO3S/c1-5-3-4-7-8(6(5)2)12-10(13)9(16-7)11(14)15/h3-4,9H,1-2H3,(H,12,13)(H,14,15) |
| InChiKey: | InChIKey=YHTGZJJJIJMUGC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.