* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 68282 |
| English Synonyms: | KINGSHCHEM 68282 |
| MDL Number.: | MFCD17212765 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)CC1C(=O)Nc2cc(ccc2S1)F |
| InChi: | InChI=1S/C12H12FNO3S/c1-2-17-11(15)6-10-12(16)14-8-5-7(13)3-4-9(8)18-10/h3-5,10H,2,6H2,1H3,(H,14,16) |
| InChiKey: | InChIKey=FSCKUEKGXOXERM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.