* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-CHLORO-2-N-(2-METHOXYETHYL)-2-N,4-N,4-N-TRIMETHYL-1,3,5-TRIAZINE-2,4-DIAMINE |
English Synonyms: | 6-CHLORO-2-N-(2-METHOXYETHYL)-2-N,4-N,4-N-TRIMETHYL-1,3,5-TRIAZINE-2,4-DIAMINE |
MDL Number.: | MFCD17237478 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CN(C)c1nc(nc(n1)Cl)N(C)CCOC |
InChi: | InChI=1S/C9H16ClN5O/c1-14(2)8-11-7(10)12-9(13-8)15(3)5-6-16-4/h5-6H2,1-4H3 |
InChiKey: | InChIKey=WAKNVKSUJXNFFX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.