* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH562301 |
English Synonyms: | FCHGROUP FCH562301 |
MDL Number.: | MFCD17325743 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCNCc1ccnc(c1)N2CCS(=O)(=O)CC2 |
InChi: | InChI=1S/C12H19N3O2S/c1-2-13-10-11-3-4-14-12(9-11)15-5-7-18(16,17)8-6-15/h3-4,9,13H,2,5-8,10H2,1H3 |
InChiKey: | InChIKey=ONXXRUQBMATKLC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.