* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH577156 |
| English Synonyms: | FCHGROUP FCH577156 |
| MDL Number.: | MFCD17339450 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC1CC1NC(=O)c2ccc(c(c2)F)/C=C/C(=O)O |
| InChi: | InChI=1S/C14H14FNO3/c1-8-6-12(8)16-14(19)10-3-2-9(11(15)7-10)4-5-13(17)18/h2-5,7-8,12H,6H2,1H3,(H,16,19)(H,17,18)/b5-4+ |
| InChiKey: | InChIKey=BZHAUQXBVWDCDC-SNAWJCMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.