* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH579986 |
English Synonyms: | FCHGROUP FCH579986 |
MDL Number.: | MFCD17340269 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC(C1CCCCC1)n2c(=O)c3ccsc3nc2S |
InChi: | InChI=1S/C14H18N2OS2/c1-9(10-5-3-2-4-6-10)16-13(17)11-7-8-19-12(11)15-14(16)18/h7-10H,2-6H2,1H3,(H,15,18) |
InChiKey: | InChIKey=YUBJUNDNUIDXLS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.