* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH594211 |
English Synonyms: | FCHGROUP FCH594211 |
MDL Number.: | MFCD17354275 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cnc(=O)n(c1)CC(=O)NC2(CCCCC2)CO |
InChi: | InChI=1S/C13H19N3O3/c17-10-13(5-2-1-3-6-13)15-11(18)9-16-8-4-7-14-12(16)19/h4,7-8,17H,1-3,5-6,9-10H2,(H,15,18) |
InChiKey: | InChIKey=QOJYBVVOEZDHCA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.