* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH652790 |
English Synonyms: | FCHGROUP FCH652790 |
MDL Number.: | MFCD17407202 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | C1CN(CC1O)C(=O)N[C@@H](CCC(=O)N)C(=O)O |
InChi: | InChI=1S/C10H17N3O5/c11-8(15)2-1-7(9(16)17)12-10(18)13-4-3-6(14)5-13/h6-7,14H,1-5H2,(H2,11,15)(H,12,18)(H,16,17)/t6?,7-/m0/s1 |
InChiKey: | InChIKey=YGOPROXFVXWRRC-MLWJPKLSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.