* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH659414 |
| English Synonyms: | FCHGROUP FCH659414 |
| MDL Number.: | MFCD17412524 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCCn1ccnc1CNCc2c[nH]nc2C |
| InChi: | InChI=1S/C12H19N5/c1-3-5-17-6-4-14-12(17)9-13-7-11-8-15-16-10(11)2/h4,6,8,13H,3,5,7,9H2,1-2H3,(H,15,16) |
| InChiKey: | InChIKey=SGRGXRYJJSANJF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.