* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH659416 |
| English Synonyms: | FCHGROUP FCH659416 |
| MDL Number.: | MFCD17412526 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCCn1ccnc1CNCCCS(=O)(=O)C |
| InChi: | InChI=1S/C11H21N3O2S/c1-3-7-14-8-6-13-11(14)10-12-5-4-9-17(2,15)16/h6,8,12H,3-5,7,9-10H2,1-2H3 |
| InChiKey: | InChIKey=CLNTYEGNNYQPLQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.