* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH660498 |
English Synonyms: | FCHGROUP FCH660498 |
MDL Number.: | MFCD17413576 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1CN(CCCO1)Cc2ccc(s2)/C=C/C(=O)O |
InChi: | InChI=1S/C14H19NO3S/c1-11-9-15(7-2-8-18-11)10-13-4-3-12(19-13)5-6-14(16)17/h3-6,11H,2,7-10H2,1H3,(H,16,17)/b6-5+ |
InChiKey: | InChIKey=RLSZVDHAKFRVLI-AATRIKPKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.