* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH672718 |
English Synonyms: | FCHGROUP FCH672718 |
MDL Number.: | MFCD17424449 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1csc2c1CN(CC2)c3c(cc(cc3F)C=O)F |
InChi: | InChI=1S/C14H11F2NOS/c15-11-5-9(8-18)6-12(16)14(11)17-3-1-13-10(7-17)2-4-19-13/h2,4-6,8H,1,3,7H2 |
InChiKey: | InChIKey=GIARJMWYEKFRRV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.