* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH673263 |
| English Synonyms: | FCHGROUP FCH673263 |
| MDL Number.: | MFCD17424992 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1c(cccc1NCCCCn2ccnc2)N |
| InChi: | InChI=1S/C14H20N4/c1-12-13(15)5-4-6-14(12)17-7-2-3-9-18-10-8-16-11-18/h4-6,8,10-11,17H,2-3,7,9,15H2,1H3 |
| InChiKey: | InChIKey=XQZZHSIQZQZXKY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.