* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH676038 |
English Synonyms: | FCHGROUP FCH676038 |
MDL Number.: | MFCD17427733 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCn1cc(cn1)C(C(C)(C)c2ccccc2)O |
InChi: | InChI=1S/C16H22N2O/c1-4-10-18-12-13(11-17-18)15(19)16(2,3)14-8-6-5-7-9-14/h5-9,11-12,15,19H,4,10H2,1-3H3 |
InChiKey: | InChIKey=BTLNBBSFENNWJJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.