* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH676101 |
English Synonyms: | FCHGROUP FCH676101 |
MDL Number.: | MFCD17427796 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(c1[nH]c(nn1)C(C)(C)c2ccccc2)N |
InChi: | InChI=1S/C13H18N4/c1-9(14)11-15-12(17-16-11)13(2,3)10-7-5-4-6-8-10/h4-9H,14H2,1-3H3,(H,15,16,17) |
InChiKey: | InChIKey=CIKQUMLHACHUOH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.