* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH634015 |
English Synonyms: | FCHGROUP FCH634015 |
MDL Number.: | MFCD17430259 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1c(csc1CC(=O)[C@@]23C[C@H]4C[C@@H](C2)C[C@H](C4)C3)Br |
InChi: | InChI=1S/C16H19BrOS/c17-13-4-14(19-9-13)5-15(18)16-6-10-1-11(7-16)3-12(2-10)8-16/h4,9-12H,1-3,5-8H2/t10-,11+,12-,16- |
InChiKey: | InChIKey=DNLXKEAMPVYARA-BZQOWKENSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.