* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH634026 |
English Synonyms: | FCHGROUP FCH634026 |
MDL Number.: | MFCD17430264 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CNC(c1cccnc1)[C@@]23C[C@H]4C[C@@H](C2)C[C@H](C4)C3 |
InChi: | InChI=1S/C17H24N2/c1-18-16(15-3-2-4-19-11-15)17-8-12-5-13(9-17)7-14(6-12)10-17/h2-4,11-14,16,18H,5-10H2,1H3/t12-,13+,14-,16?,17- |
InChiKey: | InChIKey=CPQVTXONOFGRCO-SCJBWTHFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.