* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH671771 |
English Synonyms: | FCHGROUP FCH671771 |
MDL Number.: | MFCD17430280 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CNc1cc(n[nH]1)[C@@]23C[C@H]4C[C@@H](C2)C[C@H](C4)C3 |
InChi: | InChI=1S/C14H21N3/c1-15-13-5-12(16-17-13)14-6-9-2-10(7-14)4-11(3-9)8-14/h5,9-11H,2-4,6-8H2,1H3,(H2,15,16,17)/t9-,10+,11-,14- |
InChiKey: | InChIKey=WMYBOGXHMVCULH-UAMPICCDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.