* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IBSCREEN-BB BB_NC-0931 |
English Synonyms: | IBSCREEN-BB BB_NC-0931 |
MDL Number.: | MFCD17430289 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)C[C@@H](C(=O)O)NC(=O)N2C[C@@H]3C[C@H](C2)c4cccc(=O)n4C3 |
InChi: | InChI=1S/C21H23N3O4/c25-19-8-4-7-18-16-9-15(12-24(18)19)11-23(13-16)21(28)22-17(20(26)27)10-14-5-2-1-3-6-14/h1-8,15-17H,9-13H2,(H,22,28)(H,26,27)/t15-,16+,17-/m0/s1 |
InChiKey: | InChIKey=IZAYJNCKDMBXTP-BBWFWOEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.