* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IBSCREEN-BB BB_NC-1039 |
English Synonyms: | IBSCREEN-BB BB_NC-1039 |
MDL Number.: | MFCD17430290 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CN1CC[C@@]23CC(=O)C(=C[C@@H]2[C@@H]1CC4=C3C(=O)C(C=C4)OC)OC.Cl |
InChi: | InChI=1S/C19H23NO4.ClH/c1-20-7-6-19-10-14(21)16(24-3)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19;/h4-5,9,12-13,15H,6-8,10H2,1-3H3;1H/t12-,13+,15?,19-;/m1./s1 |
InChiKey: | InChIKey=TVQNCMPUKJWDQS-UZAQSPIYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.