* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC522524 |
English Synonyms: | BCH-RESEARCH BC522524 |
MDL Number.: | MFCD17432827 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1ccccc1CSC2CS(=O)(=O)CC2O |
InChi: | InChI=1S/C12H16O3S2/c1-9-4-2-3-5-10(9)6-16-12-8-17(14,15)7-11(12)13/h2-5,11-13H,6-8H2,1H3 |
InChiKey: | InChIKey=KXGIBLJNIJOCKE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.