* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC434085 |
| English Synonyms: | BCH-RESEARCH BC434085 |
| MDL Number.: | MFCD17437959 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1cc(ccc1S(=O)(=O)NC(C)CC#N)F |
| InChi: | InChI=1S/C11H13FN2O2S/c1-8-7-10(12)3-4-11(8)17(15,16)14-9(2)5-6-13/h3-4,7,9,14H,5H2,1-2H3 |
| InChiKey: | InChIKey=OZMAPHCQBSJNQG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.