* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-[(1-ETHYL-1H-IMIDAZOL-2-YL)OXY]NAPHTHALEN-2-OL |
English Synonyms: | 3-[(1-ETHYL-1H-IMIDAZOL-2-YL)OXY]NAPHTHALEN-2-OL |
MDL Number.: | MFCD17444966 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCn1ccnc1Oc2cc3ccccc3cc2O |
InChi: | InChI=1S/C15H14N2O2/c1-2-17-8-7-16-15(17)19-14-10-12-6-4-3-5-11(12)9-13(14)18/h3-10,18H,2H2,1H3 |
InChiKey: | InChIKey=PJFZHPSFAAGJRL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.