* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-CHLORO-5-(PIPERIDIN-3-YL)PYRIDIN-2-OL |
English Synonyms: | 6-CHLORO-5-(PIPERIDIN-3-YL)PYRIDIN-2-OL |
MDL Number.: | MFCD17488620 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc(nc(c1C2CCCNC2)Cl)O |
InChi: | InChI=1S/C10H13ClN2O/c11-10-8(3-4-9(14)13-10)7-2-1-5-12-6-7/h3-4,7,12H,1-2,5-6H2,(H,13,14) |
InChiKey: | InChIKey=ODPCIXLJSBUPBA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.