* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5852106 |
| English Synonyms: | ABAMACHEM ABA-5852106 |
| MDL Number.: | MFCD17992879 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCc1nccn1CCNCc2ccc(s2)C |
| InChi: | InChI=1S/C13H19N3S/c1-3-13-15-7-9-16(13)8-6-14-10-12-5-4-11(2)17-12/h4-5,7,9,14H,3,6,8,10H2,1-2H3 |
| InChiKey: | InChIKey=PYPMTMIVICREHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.