* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5853393 |
| English Synonyms: | ABAMACHEM ABA-5853393 |
| MDL Number.: | MFCD17994079 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(CNCc1ccco1)OC2CCCCCC2 |
| InChi: | InChI=1S/C15H25NO2/c1-13(11-16-12-15-9-6-10-17-15)18-14-7-4-2-3-5-8-14/h6,9-10,13-14,16H,2-5,7-8,11-12H2,1H3 |
| InChiKey: | InChIKey=REZKOKYAKBGIHD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.