* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5864671 |
English Synonyms: | ABAMACHEM ABA-5864671 |
MDL Number.: | MFCD18004029 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | CC(CNC(=O)c1cccc(c1O)OC)/C(=N/O)/N |
InChi: | InChI=1S/C12H17N3O4/c1-7(11(13)15-18)6-14-12(17)8-4-3-5-9(19-2)10(8)16/h3-5,7,16,18H,6H2,1-2H3,(H2,13,15)(H,14,17) |
InChiKey: | InChIKey=QVKSCUCSBPOEHQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.