* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5867904 |
| English Synonyms: | ABAMACHEM ABA-5867904 |
| MDL Number.: | MFCD18007216 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CC(CNC(=O)c1ccc2cn[nH]c2c1)C(=O)O |
| InChi: | InChI=1S/C12H13N3O3/c1-7(12(17)18)5-13-11(16)8-2-3-9-6-14-15-10(9)4-8/h2-4,6-7H,5H2,1H3,(H,13,16)(H,14,15)(H,17,18) |
| InChiKey: | InChIKey=PGDNXVHNYSXFPZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.