* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5869782 |
| English Synonyms: | ABAMACHEM ABA-5869782 |
| MDL Number.: | MFCD18009054 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | CCNc1cc(ccc1[N+](=O)[O-])C(=O)NCC(=O)N |
| InChi: | InChI=1S/C11H14N4O4/c1-2-13-8-5-7(3-4-9(8)15(18)19)11(17)14-6-10(12)16/h3-5,13H,2,6H2,1H3,(H2,12,16)(H,14,17) |
| InChiKey: | InChIKey=QCNJMPWNKCDNAO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.