* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5869811 |
English Synonyms: | ABAMACHEM ABA-5869811 |
MDL Number.: | MFCD18009083 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | CNC(=O)CCNC(=O)c1ccc(c(c1)N)[N+](=O)[O-] |
InChi: | InChI=1S/C11H14N4O4/c1-13-10(16)4-5-14-11(17)7-2-3-9(15(18)19)8(12)6-7/h2-3,6H,4-5,12H2,1H3,(H,13,16)(H,14,17) |
InChiKey: | InChIKey=UVLBXPAKPUREEQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.