* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(2H-1,3-BENZODIOXOL-5-YL)-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
English Synonyms: | 8-(2H-1,3-BENZODIOXOL-5-YL)-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
MDL Number.: | MFCD18012561 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc2c(cc1N3C4CCC3CC(C4)N)OCO2 |
InChi: | InChI=1S/C14H18N2O2/c15-9-5-10-1-2-11(6-9)16(10)12-3-4-13-14(7-12)18-8-17-13/h3-4,7,9-11H,1-2,5-6,8,15H2 |
InChiKey: | InChIKey=IHHCAPHTFCSSJV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.