* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5873578 |
| English Synonyms: | ABAMACHEM ABA-5873578 |
| MDL Number.: | MFCD18012786 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCCC(CC)(C1CCS(=O)(=O)C1)C(=O)O |
| InChi: | InChI=1S/C12H22O4S/c1-3-5-7-12(4-2,11(13)14)10-6-8-17(15,16)9-10/h10H,3-9H2,1-2H3,(H,13,14) |
| InChiKey: | InChIKey=BQENSMQDOTUOFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.