* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5876472 |
| English Synonyms: | ABAMACHEM ABA-5876472 |
| MDL Number.: | MFCD18015074 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc(c(cc1Br)F)Cn2cc(cn2)CNC3CC3 |
| InChi: | InChI=1S/C14H15BrFN3/c15-12-2-1-11(14(16)5-12)9-19-8-10(7-18-19)6-17-13-3-4-13/h1-2,5,7-8,13,17H,3-4,6,9H2 |
| InChiKey: | InChIKey=PRPGCNXHCFMICU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.