* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5876508 |
| English Synonyms: | ABAMACHEM ABA-5876508 |
| MDL Number.: | MFCD18015110 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(c(c1)Cn2cc(cn2)C(C)NC)C |
| InChi: | InChI=1S/C15H21N3/c1-11-5-6-12(2)14(7-11)9-18-10-15(8-17-18)13(3)16-4/h5-8,10,13,16H,9H2,1-4H3 |
| InChiKey: | InChIKey=XWBCLNQMKHCYFV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.