* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5884253 |
| English Synonyms: | ABAMACHEM ABA-5884253 |
| MDL Number.: | MFCD18022753 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CC(C)C[C@H](C(=O)O)NC(=O)c1csc(n1)N |
| InChi: | InChI=1S/C10H15N3O3S/c1-5(2)3-6(9(15)16)12-8(14)7-4-17-10(11)13-7/h4-6H,3H2,1-2H3,(H2,11,13)(H,12,14)(H,15,16)/t6-/m1/s1 |
| InChiKey: | InChIKey=ONNIMXXABANUTG-ZCFIWIBFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.