* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5887898 |
English Synonyms: | ABAMACHEM ABA-5887898 |
MDL Number.: | MFCD18026001 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1cc(ccc1F)NCCn2ccnc2C |
InChi: | InChI=1S/C13H16FN3/c1-10-9-12(3-4-13(10)14)16-6-8-17-7-5-15-11(17)2/h3-5,7,9,16H,6,8H2,1-2H3 |
InChiKey: | InChIKey=LCMHHLIDZDZDCY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.