* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5887905 |
English Synonyms: | ABAMACHEM ABA-5887905 |
MDL Number.: | MFCD18026008 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCn1cc(cn1)C(C)Nc2cc(cc(c2F)F)F |
InChi: | InChI=1S/C13H14F3N3/c1-3-19-7-9(6-17-19)8(2)18-12-5-10(14)4-11(15)13(12)16/h4-8,18H,3H2,1-2H3 |
InChiKey: | InChIKey=NULILXUHZZOUIG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.