* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5889647 |
English Synonyms: | ABAMACHEM ABA-5889647 |
MDL Number.: | MFCD18027741 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCN(CC(C)C(=O)O)C(=O)c1cccc(c1)F |
InChi: | InChI=1S/C13H16FNO3/c1-3-15(8-9(2)13(17)18)12(16)10-5-4-6-11(14)7-10/h4-7,9H,3,8H2,1-2H3,(H,17,18) |
InChiKey: | InChIKey=NEXHOIOFFJWLSP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.