* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5889649 |
English Synonyms: | ABAMACHEM ABA-5889649 |
MDL Number.: | MFCD18027743 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCN(CC(C)C(=O)O)C(=O)c1ccc(c(c1)F)C |
InChi: | InChI=1S/C14H18FNO3/c1-4-16(8-10(3)14(18)19)13(17)11-6-5-9(2)12(15)7-11/h5-7,10H,4,8H2,1-3H3,(H,18,19) |
InChiKey: | InChIKey=RCVKVPONURVLBW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.