* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BROMOIMIDAZO[1,2-A]PYRAZINE |
| CAS: | 69214-34-2 |
| English Synonyms: | 8-BROMOIMIDAZO[1,2-A]PYRAZINE |
| MDL Number.: | MFCD18072715 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cn2ccnc(c2n1)Br |
| InChi: | InChI=1S/C6H4BrN3/c7-5-6-9-2-4-10(6)3-1-8-5/h1-4H |
| InChiKey: | InChIKey=ONYMKASWIDXNGH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.