* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VCH 916 |
| CAS: | 1200133-34-1 |
| English Synonyms: | VCH 916 |
| MDL Number.: | MFCD18089859 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cc1c(cc(s1)C2=CCCCC2)[N@](C3CCC(CC3)OC)C(=O)C4CCC(CC4)C |
| InChi: | InChI=1S/C26H39NO2S/c1-18-9-11-21(12-10-18)26(28)27(22-13-15-23(29-3)16-14-22)24-17-25(30-19(24)2)20-7-5-4-6-8-20/h7,17-18,21-23H,4-6,8-16H2,1-3H3 |
| InChiKey: | InChIKey=LFTPALYIAYDIEZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.