* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW039223 |
English Synonyms: | ZERENEX ZXW039223 |
MDL Number.: | MFCD18475216 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1ccc(c(c1)C)C(C)N(C)CC(=O)N2CCNCC2 |
InChi: | InChI=1S/C17H27N3O/c1-13-5-6-16(14(2)11-13)15(3)19(4)12-17(21)20-9-7-18-8-10-20/h5-6,11,15,18H,7-10,12H2,1-4H3 |
InChiKey: | InChIKey=USSZKAGFPBNYHY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.