* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW039606 |
English Synonyms: | ZERENEX ZXW039606 |
MDL Number.: | MFCD18475469 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1cccc(c1)OCCN(C)CC(=O)N2CCNCC2 |
InChi: | InChI=1S/C16H25N3O2/c1-14-4-3-5-15(12-14)21-11-10-18(2)13-16(20)19-8-6-17-7-9-19/h3-5,12,17H,6-11,13H2,1-2H3 |
InChiKey: | InChIKey=IWLAVLIEGFWTMK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.