* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW040112 |
English Synonyms: | ZERENEX ZXW040112 |
MDL Number.: | MFCD18475717 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | c1cc(ccc1CCNC(=O)Nc2ccc(cc2)Cl)O |
InChi: | InChI=1S/C15H15ClN2O2/c16-12-3-5-13(6-4-12)18-15(20)17-10-9-11-1-7-14(19)8-2-11/h1-8,19H,9-10H2,(H2,17,18,20) |
InChiKey: | InChIKey=HAJBJZCYLWWYJM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.