* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX E/1101367 |
| English Synonyms: | ZERENEX E/1101367 |
| MDL Number.: | MFCD18480743 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC/C(=N\Nc1nc2cc(c(c(c2s1)C)NC(=O)c3cc4ccccc4cc3OC)C)/C |
| InChi: | InChI=1S/C25H26N4O2S/c1-6-15(3)28-29-25-26-20-11-14(2)22(16(4)23(20)32-25)27-24(30)19-12-17-9-7-8-10-18(17)13-21(19)31-5/h7-13H,6H2,1-5H3,(H,26,29)(H,27,30)/b28-15- |
| InChiKey: | InChIKey=FJFPQBXTNBLYIN-MBTHVWNTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.