* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX E/1102653 |
| English Synonyms: | ZERENEX E/1102653 |
| MDL Number.: | MFCD18481424 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCN1CCN(CC1)c2cc(c(cc2[N+](=O)[O-])Cl)NC(=O)c3ccc(cc3)Cl |
| InChi: | InChI=1S/C19H20Cl2N4O3/c1-2-23-7-9-24(10-8-23)17-12-16(15(21)11-18(17)25(27)28)22-19(26)13-3-5-14(20)6-4-13/h3-6,11-12H,2,7-10H2,1H3,(H,22,26) |
| InChiKey: | InChIKey=FUZIILGAVUHARP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.