* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1103137 |
English Synonyms: | ZERENEX E/1103137 |
MDL Number.: | MFCD18481669 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(=NNc1nc2ccc(cc2s1)NC(=O)Cc3ccccc3)C |
InChi: | InChI=1S/C18H18N4OS/c1-12(2)21-22-18-20-15-9-8-14(11-16(15)24-18)19-17(23)10-13-6-4-3-5-7-13/h3-9,11H,10H2,1-2H3,(H,19,23)(H,20,22) |
InChiKey: | InChIKey=NPYHHQWFWJPVGR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.