* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CHEMMAKER BCB-98585 |
| English Synonyms: | CHEMMAKER BCB-98585 |
| MDL Number.: | MFCD18778509 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccccc2CN3CCC(CC3)C(C)(C)C |
| InChi: | InChI=1S/C22H36BNO2/c1-20(2,3)18-12-14-24(15-13-18)16-17-10-8-9-11-19(17)23-25-21(4,5)22(6,7)26-23/h8-11,18H,12-16H2,1-7H3 |
| InChiKey: | InChIKey=OUQWFQYBLYLWTQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.