* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-ETHYL-1,6-NAPHTHYRIDINE |
| CAS: | 52816-68-9 |
| English Synonyms: | 2-ETHYL-1,6-NAPHTHYRIDINE |
| MDL Number.: | MFCD18802753 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCc1ccc2cnccc2n1 |
| InChi: | InChI=1S/C10H10N2/c1-2-9-4-3-8-7-11-6-5-10(8)12-9/h3-7H,2H2,1H3 |
| InChiKey: | InChIKey=PSSPPIFHACYXBI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.